2-amino-9-[5-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl]-3H-purin-6-one structure
|
Common Name | 2-amino-9-[5-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl]-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 103083-41-6 | Molecular Weight | 477.94600 | |
| Density | 1.49g/cm3 | Boiling Point | 802.3ºC at 760mmHg | |
| Molecular Formula | C24H24ClN7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 439ºC | |
| Name | 2-amino-9-[5-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl]-3H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 802.3ºC at 760mmHg |
| Molecular Formula | C24H24ClN7O2 |
| Molecular Weight | 477.94600 |
| Flash Point | 439ºC |
| Exact Mass | 477.16800 |
| PSA | 127.96000 |
| LogP | 4.11190 |
| Vapour Pressure | 9.18E-26mmHg at 25°C |
| Index of Refraction | 1.735 |
| InChIKey | WZOKBBJTDBAWOW-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCCCCCn3cnc4c(=O)[nH]c(N)nc43)c2c1 |
|
~%
2-amino-9-[5-[(... CAS#:103083-41-6 |
| Literature: Constant; Carden; Lhomme Journal of Heterocyclic Chemistry, 1985 , vol. 22, # 4 p. 1035 - 1040 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-amino-9-{5-[(6-chloro-2-methoxyacridin-9-yl)amino]pentyl}-3,9-dihydro-6h-purin-6-one |
| 6-chloro-2-methoxy-9-<(5-(guan-9-yl)pentyl)amino>acridine |
| 6H-Purin-6-one,2-amino-9-[5-[(6-chloro-2-methoxy-9-acridinyl)amino]pentyl]-1,9-dihydro |