N,N-diethylethanamine,phthalic acid structure
|
Common Name | N,N-diethylethanamine,phthalic acid | ||
|---|---|---|---|---|
| CAS Number | 103083-67-6 | Molecular Weight | 267.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethylethanamine,phthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H21NO4 |
|---|---|
| Molecular Weight | 267.32100 |
| Exact Mass | 267.14700 |
| PSA | 77.84000 |
| LogP | 2.43110 |
| InChIKey | JLIOOYQWWAUHRC-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.O=C(O)c1ccccc1C(=O)O |
| 1,2-Benzenedicarboxylic acid,compd. with N,N-diethylethanamine |
| 1,2-Benzenedicarboxylic acid,compd. with N,N-diethylethanamine(1:1) |