2-[(3-nitrophenoxy)methyl]-1,3-benzothiazole structure
|
Common Name | 2-[(3-nitrophenoxy)methyl]-1,3-benzothiazole | ||
|---|---|---|---|---|
| CAS Number | 103089-75-4 | Molecular Weight | 286.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(3-nitrophenoxy)methyl]-1,3-benzothiazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10N2O3S |
|---|---|
| Molecular Weight | 286.30600 |
| Exact Mass | 286.04100 |
| PSA | 96.18000 |
| LogP | 4.30670 |
| InChIKey | SWRYJOQVSHRUAJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(OCc2nc3ccccc3s2)c1 |
|
~86%
2-[(3-nitrophen... CAS#:103089-75-4 |
| Literature: Journal of medicinal chemistry, , vol. 30, # 2 p. 400 - 405 |
|
~%
2-[(3-nitrophen... CAS#:103089-75-4 |
| Literature: Journal of medicinal chemistry, , vol. 30, # 2 p. 400 - 405 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(2-benzthiazoylmethoxy)nitrobenzene |
| 3-[(2-benzthiazolyl)methoxy]nitrobenzene |
| Benzothiazole,2-[(3-nitrophenoxy)methyl] |
| 3-[(2-benzothiazolyl)methoxy]nitrobenzene |