triisothiocyanato(phenyl)silane structure
|
Common Name | triisothiocyanato(phenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 10310-44-8 | Molecular Weight | 279.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5N3S3Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triisothiocyanato(phenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5N3S3Si |
|---|---|
| Molecular Weight | 279.43700 |
| Exact Mass | 278.94100 |
| PSA | 133.35000 |
| LogP | 2.14090 |
| InChIKey | VJUBALBRDWKZAT-UHFFFAOYSA-N |
| SMILES | S=C=N[Si](N=C=S)(N=C=S)c1ccccc1 |
|
~%
triisothiocyana... CAS#:10310-44-8 |
| Literature: Anderson Journal of the American Chemical Society, 1948 , vol. 70, p. 1120 |
|
~%
triisothiocyana... CAS#:10310-44-8 |
| Literature: Veszpremi, Tamas; Barta, Istvan; Nagy, Jozsef Acta Chimica Hungarica, 1986 , vol. 122, # 3-4 p. 243 - 250 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Phenyl-silantriyltriisothiocyanat |
| triisothiocyanato-phenyl-silane |
| Silane,triisothiocyanatophenyl |