Cyclohexaneacetic acid, 4-[4-(hydroxyMethyl)phenyl]-, ethyl ester, trans- structure
|
Common Name | Cyclohexaneacetic acid, 4-[4-(hydroxyMethyl)phenyl]-, ethyl ester, trans- | ||
|---|---|---|---|---|
| CAS Number | 1031336-84-1 | Molecular Weight | 276.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl {trans-4-[4-(hydroxymethyl)phenyl]cyclohexyl}acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H24O3 |
|---|---|
| Molecular Weight | 276.37100 |
| Exact Mass | 276.17300 |
| PSA | 46.53000 |
| LogP | 3.40590 |
| InChIKey | BFXUNDLRLBYENP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CCC(c2ccc(CO)cc2)CC1 |
|
~52%
Cyclohexaneacet... CAS#:1031336-84-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 4 p. 1751 - 1757 |
|
~%
Cyclohexaneacet... CAS#:1031336-84-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 55, # 4 p. 1751 - 1757 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (+-)-trans-Cyclohexan-1,2-dicarbonsaeure-dimethylester |
| dimethyl cyclohexane-trans-1,2-dicarboxylate |
| Dimethyl trans-1,2-Cyclohexanedicarboxylate |
| trans dimethyl cyclohexane-1,2-dicarboxylate |
| trans-ethyl 2-4-((4-(hydroxymethyl)phenyl)cyclohexyl)acetate |
| trans-dimethyl 1,2-cyclohexanedicarboxylate |
| cyclohexane-trans-1,2-dicarboxylic acid dimethyl ester |
| (+-)-trans-cyclohexane-1,2-dicarboxylic acid dimethyl ester |
| trans ethyl 2-(4-(4-(cyanomethyl)phenyl)cyclohexyl)acetate |
| trans-1,2-Cyclohexanedicarboxylic Acid Dimethyl Ester |