1-Azoniabicyclo[2.2.2]octane,3-oxo-1-(phenylmethyl)-, bromide (1:1) structure
|
Common Name | 1-Azoniabicyclo[2.2.2]octane,3-oxo-1-(phenylmethyl)-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 10315-08-9 | Molecular Weight | 296.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-benzyl-1-azoniabicyclo[2.2.2]octan-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18BrNO |
|---|---|
| Molecular Weight | 296.20300 |
| Exact Mass | 295.05700 |
| PSA | 17.07000 |
| InChIKey | FVHJUTYAQQXYIV-UHFFFAOYSA-N |
| SMILES | O=C1C[N+]2(Cc3ccccc3)CCC1CC2 |
| HS Code | 2933990090 |
|---|
|
~82%
1-Azoniabicyclo... CAS#:10315-08-9 |
| Literature: Ollis, W. David; Sutherland, Ian O.; Thebtaranonth, Yodhathai Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1981 , p. 1963 - 1968 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-benzyl-3-oxoquinuclidinium bromide |