8-{[4-(2-fluorophenyl)piperazin-1-yl]carbonyl}-3-phenyl[1,2,3]triazolo[1,5-a]quinazolin-5(4H)-one structure
|
Common Name | 8-{[4-(2-fluorophenyl)piperazin-1-yl]carbonyl}-3-phenyl[1,2,3]triazolo[1,5-a]quinazolin-5(4H)-one | ||
|---|---|---|---|---|
| CAS Number | 1031663-98-5 | Molecular Weight | 468.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H21FN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-{[4-(2-fluorophenyl)piperazin-1-yl]carbonyl}-3-phenyl[1,2,3]triazolo[1,5-a]quinazolin-5(4H)-one |
|---|
| Molecular Formula | C26H21FN6O2 |
|---|---|
| Molecular Weight | 468.5 |
| InChIKey | HXKIRMSBMAJXMA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc2c(=O)nc3c(-c4ccccc4)n[nH]n3c2c1)N1CCN(c2ccccc2F)CC1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Primary Screen for Target Class Profiling of Small Molecule Inhibitors of Methyltrans...
Source: NCGC
External Id: MTASE-p
|