2-methyl-6-[[2-[[(E)-(5-methyl-6-oxo-1-cyclohexa-2,4-dienylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 2-methyl-6-[[2-[[(E)-(5-methyl-6-oxo-1-cyclohexa-2,4-dienylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 10319-01-4 | Molecular Weight | 296.36400 | |
| Density | 1.242g/cm3 | Boiling Point | 506.9ºC at 760mmHg | |
| Molecular Formula | C18H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-6-[[2-[(5-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)methylamino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 506.9ºC at 760mmHg |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.36400 |
| Exact Mass | 296.15200 |
| PSA | 65.18000 |
| LogP | 3.25260 |
| Vapour Pressure | 2.13E-10mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | WAFYGQIIQPSIEH-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C=NCCN=Cc2cccc(C)c2O)c1O |
|
~81%
2-methyl-6-[[2-... CAS#:10319-01-4 |
| Literature: Sheng, Gui-Hua; Cheng, Xiao-Shan; Wang, Xue; Huang, Di; You, Zhong-Lu; Zhu, Hai-Liang Synthesis and Reactivity in Inorganic, Metal-Organic and Nano-Metal Chemistry, 2014 , vol. 44, # 6 p. 864 - 867 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-ethane-1,2-diyl-bis(3-methyl-1-salicylideneimine) |
| bis-(3-methyl-salicylidene)-ethylenediamine |
| N,N'-bis(3-methylsalicylidene)-1,2-ethanediamine |
| 2-methyl-6-[[2-[[(E)-(5-methyl-6-oxo-1-cyclohexa-2,4-dienylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
| 3,3'-Me2-salen-H2 |
| N,N'-bis(3-methylsalicylidene)-1,2-ethylenediamine |
| N,N'-bis-(2-hydroxy-3-methyl-benzyliden)-ethylenediamine |
| (6Z)-2-methyl-6-[[2-[[(Z)-(5-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]ethylamino]methylidene]cyclohexa-2,4-dien-1-one |
| N,N'-ethylenebis(3-methylsalicylideneimine) |