4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid
Modify Date: 2026-07-03 23:10:15
4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid structure
|
Common Name | 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1032-70-8 | Molecular Weight | 278.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18O5 |
|---|---|
| Molecular Weight | 278.30 |
| InChIKey | JOLMVQGRSZXEOK-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)cc(OC)c1OC1C=CCCC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid? |
| A: SMILES notation of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid is COc1cc(C(=O)O)cc(OC)c1OC1C=CCCC1. |
| Q: What is the English name of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid? |
| A: The English name of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid is 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid. |
| Q: What is the InChIKey of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid? |
| A: InChIKey of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid is JOLMVQGRSZXEOK-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1032-70-8? |
| A: Chinese name of 1032-70-8 is 1032-70-8. |
| Q: What is the CAS number of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid? |
| A: CAS number of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid is 1032-70-8. |
| Q: What is the molecular weight of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid? |
| A: Molecular weight of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid is 278.30. |
| Q: What is the molecular formula of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid? |
| A: Molecular formula of 4-(2-Cyclohexen-1-yloxy)-3,5-dimethoxybenzoic acid is C15H18O5. |