(3,5-Diiodo-Tyr1,D-Ala2,N-Me-Phe4,glycinol5)-Enkephalin acetate salt structure
|
Common Name | (3,5-Diiodo-Tyr1,D-Ala2,N-Me-Phe4,glycinol5)-Enkephalin acetate salt | ||
|---|---|---|---|---|
| CAS Number | 103213-42-9 | Molecular Weight | 765.379 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 921.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C26H33I2N5O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 510.9±34.3 °C | |
Use of (3,5-Diiodo-Tyr1,D-Ala2,N-Me-Phe4,glycinol5)-Enkephalin acetate salt(3,5-Diiodo-Tyr1,D-Ala2,N-Me-Phe4,glycinol5)-Enkephalin is a peptide. |
| Name | 2-[[2-[2-[[2-amino-3-(4-hydroxy-3,5-diiodophenyl)propanoyl]amino]propanoylamino]acetyl]-methylamino]-N-(2-hydroxyethyl)-3-phenylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Description | (3,5-Diiodo-Tyr1,D-Ala2,N-Me-Phe4,glycinol5)-Enkephalin is a peptide. |
|---|---|
| Related Catalog | |
| References |
[1]. Birnbaum S, et al. Peptide screening. Current Opinion in Biotechnology, 1992, 3(1): 49-54. |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 921.1±65.0 °C at 760 mmHg |
| Molecular Formula | C26H33I2N5O6 |
| Molecular Weight | 765.379 |
| Flash Point | 510.9±34.3 °C |
| Exact Mass | 765.052002 |
| PSA | 174.09000 |
| LogP | 1.90 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | HVAFERGAOGMJBF-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)C(N)Cc1cc(I)c(O)c(I)c1)C(=O)NCC(=O)N(C)C(Cc1ccccc1)C(=O)NCCO |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| [3,5-diI-Tyr1,D-Ala2,N-Me-Phe4,Gly5-ol]-Enkephalin |
| 3,5-Diiodotyrosylalanylglycyl-N-(2-hydroxyethyl)-Nα-methylphenylalaninamide |
| Phenylalaninamide, 3,5-diiodotyrosylalanylglycyl-N-(2-hydroxyethyl)-Nα-methyl- |
| [3,5-Diodo-Tyr1]-DAGO |
| 3,5-Diiodo-Tyr-D-Ala-Gly-N-Methyl-Phe-Gly-ol |
| DALA-GLY-PHE-MET-NH2 |
| Enkephalins |
| (3,5-Diiodo-Tyr1,D-Ala2,N-Me-Phe4,glycinol5)-Enkephalin |