tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate structure
|
Common Name | tert-Butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1032158-48-7 | Molecular Weight | 240.342 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 315.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.4±27.9 °C | |
| Name | 7-Boc-1-oxo-2,7-diazaspiro[3.5]nonane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.2±42.0 °C at 760 mmHg |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.342 |
| Flash Point | 144.4±27.9 °C |
| Exact Mass | 240.183777 |
| PSA | 32.78000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | LQQAOPZWMYAJSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNC2=O |
| Storage condition | -20°C |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 3-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| 2-Methyl-2-propanyl 7-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| tert-butyl 7-methyl-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| 2,7-Diazaspiro[3.5]nonane-2-carboxylic acid, 7-methyl-, 1,1-dimethylethyl ester |
| tert-Butyl-7-methyl-2,7-diazaspiro[3.5]nonan-2-carboxylat |
| tert-butyl 1-oxo-2,7-diazaspiro[3.5]nonane-7-carboxylate |