7-(Trimethylstannyl)isoquinoline structure
|
Common Name | 7-(Trimethylstannyl)isoquinoline | ||
|---|---|---|---|---|
| CAS Number | 1032315-16-4 | Molecular Weight | 294.97900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18NSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(Trimethylstannyl)isoquinoline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H18NSn |
|---|---|
| Molecular Weight | 294.97900 |
| Exact Mass | 296.04600 |
| PSA | 12.89000 |
| LogP | 2.57150 |
| InChIKey | LRRANMIEIZZDCJ-UHFFFAOYSA-N |
| SMILES | C[Sn](C)(C)c1ccc2ccncc2c1 |
| HS Code | 2933499090 |
|---|
|
~90%
7-(Trimethylsta... CAS#:1032315-16-4 |
| Literature: Shi, Jun; Manolikakes, Georg; Yeh, Chien-Hung; Guerrero, Carlos A.; Shenvi, Ryan A.; Shigehisa, Hiroki; Baran, Phil S. Journal of the American Chemical Society, 2011 , vol. 133, # 20 p. 8014 - 8027 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-isopropylthio-1,3,6-trimethyllumazine |
| 2,4(1H,3H)-Pteridinedione,1,3,6-trimethyl-7-[(1-methylethyl)thio] |
| 7-isoquinolinyl-trimethylstannane |
| 7-Isopropylthio-1,3,6-trimethylpteridin-2,4(1H,3H)-dion |
| 7-isoquinolinetrimethylstannane |
| 7-trimethylstannylisoquinoline |