6-chloroneplanocin structure
|
Common Name | 6-chloroneplanocin | ||
|---|---|---|---|---|
| CAS Number | 103232-24-2 | Molecular Weight | 282.68300 | |
| Density | 1.88g/cm3 | Boiling Point | 576.6ºC at 760mmHg | |
| Molecular Formula | C11H11ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.5ºC | |
| Name | (1S,2R,5R)-5-(6-chloropurin-9-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Boiling Point | 576.6ºC at 760mmHg |
| Molecular Formula | C11H11ClN4O3 |
| Molecular Weight | 282.68300 |
| Flash Point | 302.5ºC |
| Exact Mass | 282.05200 |
| PSA | 104.29000 |
| Vapour Pressure | 3.89E-14mmHg at 25°C |
| Index of Refraction | 1.827 |
| InChIKey | QHILTTBFPUOZHJ-VDAHYXPESA-N |
| SMILES | OCC1=CC(n2cnc3c(Cl)ncnc32)C(O)C1O |
|
~86%
6-chloroneplanocin CAS#:103232-24-2 |
| Literature: Shuto; Obara; Toriya; Hosoya; Snoeck; Andrei; Balzarini; De Clercq Journal of Medicinal Chemistry, 1992 , vol. 35, # 2 p. 324 - 331 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6-Chloroneplanocin |