N-ethyl-N-[(6-nitrobenzimidazol-1-yl)methyl]ethanamine structure
|
Common Name | N-ethyl-N-[(6-nitrobenzimidazol-1-yl)methyl]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 103248-16-4 | Molecular Weight | 248.28100 | |
| Density | 1.249g/cm3 | Boiling Point | 395.894ºC at 760 mmHg | |
| Molecular Formula | C12H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.23ºC | |
| Name | N-ethyl-N-[(6-nitrobenzimidazol-1-yl)methyl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 395.894ºC at 760 mmHg |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.28100 |
| Flash Point | 193.23ºC |
| Exact Mass | 248.12700 |
| PSA | 66.88000 |
| LogP | 2.76700 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | JFKCIUOSFADBCZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)Cn1cnc2ccc([N+](=O)[O-])cc21 |
|
~83%
N-ethyl-N-[(6-n... CAS#:103248-16-4 |
| Literature: Kumar, B. Vijaya; Rao, A. Bhaskar; Reddy, V. Malla Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1985 , vol. 24, p. 889 - 892 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N-Diethyl-6-nitro-1H-benzimidazole-1-methanamine |
| 1H-Benzimidazole-1-methanamine,N,N-diethyl-6-nitro |