Benzene,1-(4-fluorophenoxy)-2,4-dinitro- structure
|
Common Name | Benzene,1-(4-fluorophenoxy)-2,4-dinitro- | ||
|---|---|---|---|---|
| CAS Number | 1033-02-9 | Molecular Weight | 278.19300 | |
| Density | 1.48g/cm3 | Boiling Point | 359.5ºC at 760mmHg | |
| Molecular Formula | C12H7FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.2ºC | |
| Name | 1-(4-fluorophenoxy)-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 359.5ºC at 760mmHg |
| Molecular Formula | C12H7FN2O5 |
| Molecular Weight | 278.19300 |
| Flash Point | 171.2ºC |
| Exact Mass | 278.03400 |
| PSA | 100.87000 |
| LogP | 4.48080 |
| Vapour Pressure | 4.9E-05mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | ZKMOMHWTRWMDBT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(F)cc2)c([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-dinitrophenyl 4-fluorophenyl ether |
| 2,4-Dinitro-4'-fluoro-diphenylether |