2,5-DIPHENYL-1,6,6A-TRITHIAPENTALENE structure
|
Common Name | 2,5-DIPHENYL-1,6,6A-TRITHIAPENTALENE | ||
|---|---|---|---|---|
| CAS Number | 1033-90-5 | Molecular Weight | 313.48000 | |
| Density | 1.34g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H13S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,7-diphenyl-1λ4,2,8-trithiabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Molecular Formula | C17H13S3 |
| Molecular Weight | 313.48000 |
| Exact Mass | 313.01800 |
| PSA | 75.90000 |
| LogP | 6.24520 |
| Index of Refraction | 1.742 |
| InChIKey | SRYTYXMHFJHYIZ-UHFFFAOYSA-N |
| SMILES | C1=C(c2ccccc2)SS2=C1C=C(c1ccccc1)S2 |
|
~78%
2,5-DIPHENYL-1,... CAS#:1033-90-5 |
| Literature: Phosphorus, Sulfur and Silicon and the Related Elements, , vol. 73, # 1-4 p. 229 - 234 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-Diphenyl-6aSIV-1,6,6a,trithia-pentalen |
| 2,5-Diphenyl-1,6,6a|E4-trithiapentalene |
| 2,5-diphenyl-6-thiathiophthene |
| 2,5-Diphenyl-1,6,6a-IVS-trithia-pentalen |
| 1,6,6a-SIV-trithiapentalene,2,5-diphenyl |
| 2,5-Diphenyl-6a-thiathiophthene |