Fmoc-Val-Cl structure
|
Common Name | Fmoc-Val-Cl | ||
|---|---|---|---|---|
| CAS Number | 103321-53-5 | Molecular Weight | 357.831 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 508.7±33.0 °C at 760 mmHg | |
| Molecular Formula | C20H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.4±25.4 °C | |
| Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-chloro-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.7±33.0 °C at 760 mmHg |
| Molecular Formula | C20H20ClNO3 |
| Molecular Weight | 357.831 |
| Flash Point | 261.4±25.4 °C |
| Exact Mass | 357.113159 |
| PSA | 55.40000 |
| LogP | 5.16 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | OJVUGYYHLWTNDI-SFHVURJKSA-N |
| SMILES | CC(C)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Cl |
| HS Code | 2924299090 |
|---|
|
~99%
Fmoc-Val-Cl CAS#:103321-53-5 |
| Literature: Chemistry - A European Journal, , vol. 14, # 15 p. 4488 - 4502 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 9H-Fluoren-9-ylmethyl [(2S)-1-chloro-3-methyl-1-oxo-2-butanyl]carbamate |
| Fmoc-L-Val-Cl |
| N-Fmoc-L-valine chloride |
| Fmoc-Val-Cl |
| Carbamic acid, N-[(1S)-1-(chlorocarbonyl)-2-methylpropyl]-, 9H-fluoren-9-ylmethyl ester |