3-[[4-(3-hydroxypropylamino)benzo[g]phthalazin-1-yl]amino]propan-1-ol structure
|
Common Name | 3-[[4-(3-hydroxypropylamino)benzo[g]phthalazin-1-yl]amino]propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 103344-03-2 | Molecular Weight | 326.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[[4-(3-hydroxypropylamino)benzo[g]phthalazin-1-yl]amino]propan-1-ol |
|---|
| Molecular Formula | C18H22N4O2 |
|---|---|
| Molecular Weight | 326.39300 |
| Exact Mass | 326.17400 |
| PSA | 96.76000 |
| LogP | 1.21540 |
| InChIKey | RFSJCFKDGKGOCS-UHFFFAOYSA-N |
| SMILES | OCCCNc1nnc(NCCCO)c2cc3ccccc3cc12 |
|
~98%
3-[[4-(3-hydrox... CAS#:103344-03-2 |
| Literature: Gandolfi; Beggiolin; Menta; Palumbo; Sissi; Spinelli; Johnson Journal of Medicinal Chemistry, 1995 , vol. 38, # 3 p. 526 - 536 |
|
~%
3-[[4-(3-hydrox... CAS#:103344-03-2 |
| Literature: European Journal of Medicinal Chemistry, , vol. 21, # 2 p. 143 - 149 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |