sodium,tritert-butylsilanide structure
|
Common Name | sodium,tritert-butylsilanide | ||
|---|---|---|---|---|
| CAS Number | 103349-41-3 | Molecular Weight | 223.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H28NaSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium,tritert-butylsilanide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H28NaSi |
|---|---|
| Molecular Weight | 223.42600 |
| Exact Mass | 223.18600 |
| LogP | 4.61380 |
| InChIKey | BIHQRKGZUDWWGS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si-](C(C)(C)C)C(C)(C)C.[Na+] |
|
~%
sodium,tritert-... CAS#:103349-41-3 |
| Literature: Wiberg; Amelunxen; Lerner; Schuster; Noeth; Krossing; Schmidt-Amelunxen; Seifert Journal of Organometallic Chemistry, 1997 , vol. 542, # 1 p. 1 - 18 |
|
~%
sodium,tritert-... CAS#:103349-41-3 |
| Literature: Wiberg; Amelunxen; Lerner; Schuster; Noeth; Krossing; Schmidt-Amelunxen; Seifert Journal of Organometallic Chemistry, 1997 , vol. 542, # 1 p. 1 - 18 |
| Precursor 2 | |
|---|---|
| DownStream 7 | |
| sodium tri-tert-butylsilanide |
| Supersilyl sodium |