N-(4-phenyldiazenylnaphthalen-1-yl)acetamide structure
|
Common Name | N-(4-phenyldiazenylnaphthalen-1-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 10336-20-6 | Molecular Weight | 289.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-phenyldiazenylnaphthalen-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15N3O |
|---|---|
| Molecular Weight | 289.33100 |
| Exact Mass | 289.12200 |
| PSA | 57.31000 |
| LogP | 5.86310 |
| InChIKey | MZKMYTVTYMGDTJ-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(N=Nc2ccccc2)c2ccccc12 |
|
~%
N-(4-phenyldiaz... CAS#:10336-20-6 |
| Literature: Michaelis; Erdmann Chemische Berichte, 1895 , vol. 28, p. 2195 Full Text Show Details Bergmann; Haskelberg; Bergmann Journal of the American Chemical Society, 1941 , vol. 63, p. 2245,2248 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Phenylazo-1-acetamino-naphthalin |
| 1-Phenylazo-4-acetamino-naphthalin |
| 1-Benzolazo-4-acetamino-naphthalin |