2-(4-methyl-2-oxoquinolin-1-yl)acetic acid structure
|
Common Name | 2-(4-methyl-2-oxoquinolin-1-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 103368-21-4 | Molecular Weight | 217.22100 | |
| Density | 1.298g/cm3 | Boiling Point | 389.6ºC at 760 mmHg | |
| Molecular Formula | C12H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | 2-(4-methyl-2-oxoquinolin-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 389.6ºC at 760 mmHg |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22100 |
| Flash Point | 189.4ºC |
| Exact Mass | 217.07400 |
| PSA | 59.30000 |
| LogP | 1.39450 |
| Vapour Pressure | 9.12E-07mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | VKKWCKNFSMMXJZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)n(CC(=O)O)c2ccccc12 |
| HS Code | 2933499090 |
|---|
|
~%
2-(4-methyl-2-o... CAS#:103368-21-4 |
| Literature: DeRuiter; Brubaker; Whitmer; Stein Jr. Journal of Medicinal Chemistry, 1986 , vol. 29, # 10 p. 2024 - 2028 |
|
~%
2-(4-methyl-2-o... CAS#:103368-21-4 |
| Literature: DeRuiter; Brubaker; Whitmer; Stein Jr. Journal of Medicinal Chemistry, 1986 , vol. 29, # 10 p. 2024 - 2028 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methyl-2-oxoquinoline-1-acetic acid |