N,N-dimethyl-10H-pyridazino[4,3-b][1,4]benzothiazin-3-amine structure
|
Common Name | N,N-dimethyl-10H-pyridazino[4,3-b][1,4]benzothiazin-3-amine | ||
|---|---|---|---|---|
| CAS Number | 10337-78-7 | Molecular Weight | 244.31500 | |
| Density | 1.313g/cm3 | Boiling Point | 528.8ºC at 760 mmHg | |
| Molecular Formula | C12H12N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.6ºC | |
| Name | N,N-dimethyl-10H-pyridazino[4,3-b][1,4]benzothiazin-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.313g/cm3 |
|---|---|
| Boiling Point | 528.8ºC at 760 mmHg |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.31500 |
| Flash Point | 273.6ºC |
| Exact Mass | 244.07800 |
| PSA | 66.35000 |
| LogP | 2.88880 |
| Vapour Pressure | 2.87E-11mmHg at 25°C |
| Index of Refraction | 1.691 |
| InChIKey | DUYNEAJPGBBVBX-UHFFFAOYSA-N |
| SMILES | CN(C)c1cc2c(nn1)Nc1ccccc1S2 |
|
~%
N,N-dimethyl-10... CAS#:10337-78-7 |
| Literature: Yoneda; Ohtaka; Nitta Chemical and pharmaceutical bulletin, 1966 , vol. 14, # 7 p. 698 - 706 |
|
~%
N,N-dimethyl-10... CAS#:10337-78-7 |
| Literature: Yoneda; Ohtaka; Nitta Chemical and pharmaceutical bulletin, 1966 , vol. 14, # 7 p. 698 - 706 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (10H-benzo[b]pyridazino[3,4-e][1,4]thiazin-3-yl)-dimethyl-amine |
| 3-Dimethylamino-10H-benzo<b>pyridazino<3.4-e><1.4>thiazin |