2,6-Diethyl-3-nitroaniline structure
|
Common Name | 2,6-Diethyl-3-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 103392-86-5 | Molecular Weight | 194.230 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 338.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.7±26.5 °C | |
| Name | 2,6-Diethyl-3-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 338.8±37.0 °C at 760 mmHg |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.230 |
| Flash Point | 158.7±26.5 °C |
| Exact Mass | 194.105530 |
| PSA | 71.84000 |
| LogP | 3.35 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | SNRRMXALZAFEHT-UHFFFAOYSA-N |
| SMILES | CCc1ccc([N+](=O)[O-])c(CC)c1N |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-Diethyl-3-nitroaniline |
| 3-Nitro-2,6-diaethyl-anilin |
| Benzenamine, 2,6-diethyl-3-nitro- |
| Benzenamine,2,6-diethyl-3-nitro |