4-bromo-1-ethyl-2-nitrobenzene structure
|
Common Name | 4-bromo-1-ethyl-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 10342-66-2 | Molecular Weight | 230.05900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-1-ethyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8BrNO2 |
|---|---|
| Molecular Weight | 230.05900 |
| Exact Mass | 228.97400 |
| PSA | 45.82000 |
| LogP | 3.44290 |
| InChIKey | YFEUEACCUDZRPY-UHFFFAOYSA-N |
| SMILES | CCc1ccc(Br)cc1[N+](=O)[O-] |
|
~%
4-bromo-1-ethyl... CAS#:10342-66-2 |
| Literature: SYNGENTA PARTICIPATIONS AG Patent: WO2008/110308 A2, 2008 ; Location in patent: Page/Page column 168 ; |
|
~33%
4-bromo-1-ethyl... CAS#:10342-66-2 |
| Literature: SAREUM LIMITED; READER, John Charles Patent: WO2013/117522 A1, 2013 ; Location in patent: Page/Page column 46 ; |
|
~%
4-bromo-1-ethyl... CAS#:10342-66-2 |
| Literature: SYNGENTA CROP PROTECTION LLC Patent: US2012/190545 A1, 2012 ; |
|
~27%
4-bromo-1-ethyl... CAS#:10342-66-2 |
| Literature: Liu, Wang; Lim, Hwan Jung; Rajanbabu Journal of the American Chemical Society, 2012 , vol. 134, # 12 p. 5496 - 5499 |
| 2-ethyl-5-bromonitrobenzene |
| 2-ethyl-5-bromo-1-nitrobenzene |
| 4-bromo-1-ethyl-2-nitro-benzene |
| 2-Nitro-4-brom-ethylbenzol |
| Benzene,4-bromo-1-ethyl-2-nitro |
| 4-bromanyl-1-ethyl-2-nitro-benzene |
| 5-bromo-2-ethyl-1-nitrobenzene |