GS9131 citrate
Modify Date: 2025-08-26 19:56:03
GS9131 citrate structure
|
Common Name | GS9131 citrate | ||
|---|---|---|---|---|
| CAS Number | 1034559-30-2 | Molecular Weight | 698.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H32FN6O13P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | GS9131 citrate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H32FN6O13P |
|---|---|
| Molecular Weight | 698.5 |
| InChIKey | UQNIBOGIUNYYCZ-MRDBPTFSSA-N |
| SMILES | CCOC(=O)C(C)NP(=O)(COC1C=C(F)C(n2cnc3c(N)ncnc32)O1)Oc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of GS9131 citrate? |
| A: InChIKey of GS9131 citrate is UQNIBOGIUNYYCZ-MRDBPTFSSA-N. |
| Q: What is the molecular formula of GS9131 citrate? |
| A: Molecular formula of GS9131 citrate is C27H32FN6O13P. |
| Q: What is the CAS number of GS9131 citrate? |
| A: CAS number of GS9131 citrate is 1034559-30-2. |
| Q: What is the SMILES notation of GS9131 citrate? |
| A: SMILES notation of GS9131 citrate is CCOC(=O)C(C)NP(=O)(COC1C=C(F)C(n2cnc3c(N)ncnc32)O1)Oc1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O. |
| Q: What is the English name of GS9131 citrate? |
| A: The English name of GS9131 citrate is GS9131 citrate. |
| Q: What is the Chinese name of 1034559-30-2? |
| A: Chinese name of 1034559-30-2 is 1034559-30-2. |
| Q: What is the molecular weight of GS9131 citrate? |
| A: Molecular weight of GS9131 citrate is 698.5. |