2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylacetate structure
|
Common Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 103470-83-3 | Molecular Weight | 289.28700 | |
| Density | 1.28g/cm3 | Boiling Point | 497ºC at 760mmHg | |
| Molecular Formula | C14H15N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.4ºC | |
| Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethyl 2-phenylacetate |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 497ºC at 760mmHg |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.28700 |
| Flash Point | 254.4ºC |
| Exact Mass | 289.10600 |
| PSA | 89.94000 |
| LogP | 2.40880 |
| Vapour Pressure | 5.12E-10mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | OSIQZATXFWLSAO-UHFFFAOYSA-N |
| SMILES | Cc1ncc([N+](=O)[O-])n1CCOC(=O)Cc1ccccc1 |
|
~%
2-(2-methyl-5-n... CAS#:103470-83-3 |
| Literature: Prasad Rao; Srimannarayana; Sundaramurthy Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 11 p. 1034 - 1040 |
|
~%
2-(2-methyl-5-n... CAS#:103470-83-3 |
| Literature: Prasad Rao; Srimannarayana; Sundaramurthy Indian Journal of Chemistry - Section B Organic Chemistry Including Medicinal Chemistry, 1990 , vol. 29, # 11 p. 1034 - 1040 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |