4-Quinolinamine,N-[(3,4-dimethoxyphenyl)methylene]-6,7-dimethoxy- structure
|
Common Name | 4-Quinolinamine,N-[(3,4-dimethoxyphenyl)methylene]-6,7-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 10351-50-5 | Molecular Weight | 352.38400 | |
| Density | 1.17g/cm3 | Boiling Point | 517.4ºC at 760 mmHg | |
| Molecular Formula | C20H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.7ºC | |
| Name | 1-(3,4-dimethoxyphenyl)-N-(6,7-dimethoxyquinolin-4-yl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 517.4ºC at 760 mmHg |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.38400 |
| Flash Point | 266.7ºC |
| Exact Mass | 352.14200 |
| PSA | 62.17000 |
| LogP | 4.01980 |
| Vapour Pressure | 2.68E-10mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | JIGAQXOHSFIRIS-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=Nc2ccnc3cc(OC)c(OC)cc23)cc1OC |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (3,4-dimethoxy-benzylidene)-(6,7-dimethoxy-quinolin-4-yl)-amine |
| 4-(3,7-dimethoxyquinoline |
| 4-(3,4-Dimethoxybenzylidenamino)-6,7-dimethoxychinolin |
| Leniquinsin [USAN:INN] |
| LENIQUINSIN |