2-hydroxy-N-[2-[(2-hydroxybenzoyl)amino]phenyl]benzamide structure
|
Common Name | 2-hydroxy-N-[2-[(2-hydroxybenzoyl)amino]phenyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 103528-00-3 | Molecular Weight | 348.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxy-N-[2-[(2-hydroxybenzoyl)amino]phenyl]benzamide |
|---|
| Molecular Formula | C20H16N2O4 |
|---|---|
| Molecular Weight | 348.35200 |
| Exact Mass | 348.11100 |
| PSA | 105.64000 |
| LogP | 4.37040 |
| InChIKey | MOFNUXXPJOXEQX-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1NC(=O)c1ccccc1O)c1ccccc1O |
|
~80%
2-hydroxy-N-[2-... CAS#:103528-00-3 |
| Literature: Ibrahim; Elwahy Synthesis, 1993 , # 5 p. 503 - 508 |
|
~%
2-hydroxy-N-[2-... CAS#:103528-00-3 |
| Literature: Anson, Fred C.; Collins, Terrence J.; Gipson, Stephen L.; Keech, John T.; Krafft, Terry E.; Peake, Geoffrey T. Journal of the American Chemical Society, 1986 , vol. 108, # 21 p. 6593 - 6605 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |