bis(ethenyl) nonanedioate structure
|
Common Name | bis(ethenyl) nonanedioate | ||
|---|---|---|---|---|
| CAS Number | 10355-49-4 | Molecular Weight | 240.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(ethenyl) nonanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H20O4 |
|---|---|
| Molecular Weight | 240.29500 |
| Exact Mass | 240.13600 |
| PSA | 52.60000 |
| LogP | 3.09050 |
| InChIKey | PBIUOBIXWAFQEZ-UHFFFAOYSA-N |
| SMILES | C=COC(=O)CCCCCCCC(=O)OC=C |
|
~99%
bis(ethenyl) no... CAS#:10355-49-4 |
| Literature: Ashrafuzzaman, Md.; Pyo, Jung In; Cheong, Chan Seong Bulletin of the Korean Chemical Society, 2014 , vol. 35, # 2 p. 477 - 482 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Azelainsaeure-divinylester |
| divinyl azelate |
| Nonan-1,9-disaeure-divinylester |
| Divinyl azelat |
| Nonanedioic acid,diethenyl ester |