5-Octanoyl-2,2-dimethyl-1,3-dioxane-4,6-dione structure
|
Common Name | 5-Octanoyl-2,2-dimethyl-1,3-dioxane-4,6-dione | ||
|---|---|---|---|---|
| CAS Number | 103576-44-9 | Molecular Weight | 270.32100 | |
| Density | 1.08g/cm3 | Boiling Point | 458.1ºC at 760 mmHg | |
| Molecular Formula | C14H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.1ºC | |
| Name | 5-Octanoyl-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 458.1ºC at 760 mmHg |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32100 |
| Flash Point | 204.1ºC |
| Exact Mass | 270.14700 |
| PSA | 69.67000 |
| LogP | 2.36830 |
| Vapour Pressure | 1.42E-08mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | UQMZDDUUYXBLHI-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)C1C(=O)OC(C)(C)OC1=O |
|
~%
5-Octanoyl-2,2-... CAS#:103576-44-9 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 55, # 7 p. 2186 - 2189 |
| 2,2-dimethyl-5-octanoyl-1,3-dioxane-4,6-dione |