2-[[6-[(3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl)oxy]-3-hydroxy-2-methyloxan-4-yl]amino]acetic acid structure
|
Common Name | 2-[[6-[(3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl)oxy]-3-hydroxy-2-methyloxan-4-yl]amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 103620-81-1 | Molecular Weight | 585.55600 | |
| Density | 1.58g/cm3 | Boiling Point | 851.6ºC at 760mmHg | |
| Molecular Formula | C29H31NO12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 468.8ºC | |
| Name | 2-[[6-[(3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-2,4-dihydro-1H-tetracen-1-yl)oxy]-3-hydroxy-2-methyloxan-4-yl]amino]acetic acid |
|---|
| Density | 1.58g/cm3 |
|---|---|
| Boiling Point | 851.6ºC at 760mmHg |
| Molecular Formula | C29H31NO12 |
| Molecular Weight | 585.55600 |
| Flash Point | 468.8ºC |
| Exact Mass | 585.18500 |
| PSA | 209.15000 |
| LogP | 1.13530 |
| Vapour Pressure | 7.46E-31mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | NAZFOYZZEWXVQS-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(C)=O)CC3OC1CC(NCC(=O)O)C(O)C(C)O1 |
|
~90%
2-[[6-[(3-acety... CAS#:103620-81-1 |
| Literature: Acton; Tong; Taylor; Streeter; Filppi; Wolgemuth Journal of Medicinal Chemistry, 1986 , vol. 29, # 10 p. 2074 - 2079 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |