9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide structure
|
Common Name | 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide | ||
|---|---|---|---|---|
| CAS Number | 1036915-23-7 | Molecular Weight | 437.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32F2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H32F2O5 |
|---|---|
| Molecular Weight | 437.5 |
| InChIKey | ITHJZTMTGUYYGI-XPZMJKKXSA-N |
| SMILES | CC1(C)OC2CC3C4CCC5=CC(=O)CCC5(C)C4(F)C(O)CC3(C)C2(C(=O)CF)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1036915-23-7? |
| A: Chinese name of 1036915-23-7 is 1036915-23-7. |
| Q: What is the molecular formula of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide? |
| A: Molecular formula of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide is C24H32F2O5. |
| Q: What is the SMILES notation of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide? |
| A: SMILES notation of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide is CC1(C)OC2CC3C4CCC5=CC(=O)CCC5(C)C4(F)C(O)CC3(C)C2(C(=O)CF)O1. |
| Q: What is the CAS number of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide? |
| A: CAS number of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide is 1036915-23-7. |
| Q: What is the molecular weight of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide? |
| A: Molecular weight of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide is 437.5. |
| Q: What is the InChIKey of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide? |
| A: InChIKey of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide is ITHJZTMTGUYYGI-XPZMJKKXSA-N. |
| Q: What is the English name of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide? |
| A: The English name of 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide is 9-Fluoro-(21-fluoro F-18)-11beta,16alpha,17-trihydroxypregn-4-ene-3,20-dione-16,17-acetonide. |