[3-trimethylsilyl-2-(trimethylsilylmethyl)but-2-enyl] carbonate structure
|
Common Name | [3-trimethylsilyl-2-(trimethylsilylmethyl)but-2-enyl] carbonate | ||
|---|---|---|---|---|
| CAS Number | 103693-94-3 | Molecular Weight | 273.49600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H25O3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [3-trimethylsilyl-2-(trimethylsilylmethyl)but-2-enyl] carbonate |
|---|
| Molecular Formula | C12H25O3Si2 |
|---|---|
| Molecular Weight | 273.49600 |
| Exact Mass | 273.13400 |
| PSA | 49.36000 |
| LogP | 2.87840 |
| InChIKey | KMKNAMYITXLYOQ-UHFFFAOYSA-M |
| SMILES | CC(=C(COC(=O)[O-])C[Si](C)(C)C)[Si](C)(C)C |
|
~%
[3-trimethylsil... CAS#:103693-94-3 |
| Literature: Trost, Barry M.; Mignani, Serge M.; Nanninga, Thomas N. Journal of the American Chemical Society, 1986 , vol. 108, # 19 p. 6051 - 6053 |
|
~%
[3-trimethylsil... CAS#:103693-94-3 |
| Literature: Trost, Barry M.; Mignani, Serge M.; Nanninga, Thomas N. Journal of the American Chemical Society, 1986 , vol. 108, # 19 p. 6051 - 6053 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |