diphenyl carbonate,hexane-1,6-diol,oxepan-2-one structure
|
Common Name | diphenyl carbonate,hexane-1,6-diol,oxepan-2-one | ||
|---|---|---|---|---|
| CAS Number | 103694-75-3 | Molecular Weight | 446.53300 | |
| Density | N/A | Boiling Point | 304ºC at 760mmHg | |
| Molecular Formula | C25H34O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.4ºC | |
| Name | diphenyl carbonate,hexane-1,6-diol,oxepan-2-one |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 304ºC at 760mmHg |
|---|---|
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.53300 |
| Flash Point | 119.4ºC |
| Exact Mass | 446.23000 |
| PSA | 102.29000 |
| LogP | 4.89940 |
| Vapour Pressure | 0.000899mmHg at 25°C |
| InChIKey | JCYHBQCYMZOSPP-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)Oc1ccccc1.O=C1CCCCCO1.OCCCCCCO |
| Carbonic acid,diphenyl ester,polymer with 1,6-hexanediol and 2-oxepanone |