CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl
CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl structure
|
Common Name | CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl | ||
|---|---|---|---|---|
| CAS Number | 103733-30-8 | Molecular Weight | 303.78300 | |
| Density | N/A | Boiling Point | 411.6ºC at 760mmHg | |
| Molecular Formula | C17H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 411.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C17H18ClNO2 |
| Molecular Weight | 303.78300 |
| Flash Point | 202.8ºC |
| Exact Mass | 303.10300 |
| PSA | 38.33000 |
| LogP | 3.57510 |
| Vapour Pressure | 5.5E-07mmHg at 25°C |
| InChIKey | HYKDEPCVBMNYCM-NTISSMGPSA-N |
| SMILES | Cl.O=C(OCc1ccccc1)C1Cc2ccccc2CN1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
CarboxylicAcidP... CAS#:103733-30-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 7, # 23 p. 3049 - 3052 |
|
~%
CarboxylicAcidP... CAS#:103733-30-8 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 7, # 23 p. 3049 - 3052 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (S)-1,2,3,4-Tetra hydro-3-Isoquinoline carboxylic acid phenyl methylester hydrochloride |
| 3-Isoquinolinecarboxylic acid,1,2,3,4-tetrahydro-,phenylMethyl ester,hydrochloride,(3S) |
| L-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID BENZYL ESTER HCL |
| (S)-01,2,3,4-Tetrahydroisoquinoline-3-carboxylic Acid Benzyl Ester Hydrochloride |
| (S)-Benzyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl have? |
| A: English synonyms of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl: (S)-1,2,3,4-Tetra hydro-3-Isoquinoline carboxylic acid phenyl methylester hydrochloride, 3-Isoquinolinecarboxylic acid,1,2,3,4-tetrahydro-,phenylMethyl ester,hydrochloride,(3S), L-1,2,3,4-TETRAHYDROISOQUINOLINE-3-CARBOXYLIC ACID BENZYL ESTER HCL, (S)-01,2,3,4-Tetrahydroisoquinoline-3-carboxylic Acid Benzyl Ester Hydrochloride, (S)-Benzyl 1,2,3,4-tetrahydroisoquinoline-3-carboxylate hydrochloride. |
| Q: What is the polar surface area (PSA) of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: Polar surface area (PSA) of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is 38.33000. |
| Q: What are the upstream materials of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: Related upstream materials(CAS) of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl: 100-39-0;115962-35-1. |
| Q: What is the molecular weight of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: Molecular weight of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is 303.78300. |
| Q: What is the LogP of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: LogP of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is 3.57510. |
| Q: What is the boiling point of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: Boiling point of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is 411.6ºC at 760mmHg. |
| Q: What is the CAS number of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: CAS number of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is 103733-30-8. |
| Q: What is the English name of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: The English name of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl. |
| Q: What is the InChIKey of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: InChIKey of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is HYKDEPCVBMNYCM-NTISSMGPSA-N. |
| Q: What is the molecular formula of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl? |
| A: Molecular formula of CarboxylicAcidPhenylMethylEsterHydrochloride,QuinaprilHcl is C17H18ClNO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |