(E)-3-(1H-benzoimidazol-2-ylsulfanyl)-1-phenyl-prop-2-en-1-one structure
|
Common Name | (E)-3-(1H-benzoimidazol-2-ylsulfanyl)-1-phenyl-prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 103742-55-8 | Molecular Weight | 280.34400 | |
| Density | 1.33g/cm3 | Boiling Point | 501.4ºC at 760mmHg | |
| Molecular Formula | C16H12N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.1ºC | |
| Name | 3-(1H-benzimidazol-2-ylsulfanyl)-1-phenylprop-2-en-1-one |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 501.4ºC at 760mmHg |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.34400 |
| Flash Point | 257.1ºC |
| Exact Mass | 280.06700 |
| PSA | 71.05000 |
| LogP | 4.05160 |
| Vapour Pressure | 3.47E-10mmHg at 25°C |
| Index of Refraction | 1.716 |
| InChIKey | DOPMUJWDCDQNIH-KHPPLWFESA-N |
| SMILES | O=C(C=CSc1nc2ccccc2[nH]1)c1ccccc1 |
|
~94%
(E)-3-(1H-benzo... CAS#:103742-55-8 |
| Literature: Andriyankova, L. V.; Komarova, T. N.; Nakhmanovich, A. S.; Abramova, N. D.; Skvortsova, G. G. Journal of Organic Chemistry USSR (English Translation), 1985 , vol. 21, # 12 p. 2388 - 2390 Zhurnal Organicheskoi Khimii, 1985 , vol. 21, # 12 p. 2610 - 2613 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |