N-[2-(4-nitronaphthalen-1-yl)oxyethyl]aniline structure
|
Common Name | N-[2-(4-nitronaphthalen-1-yl)oxyethyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 103769-08-0 | Molecular Weight | 308.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(4-nitronaphthalen-1-yl)oxyethyl]aniline |
|---|
| Molecular Formula | C18H16N2O3 |
|---|---|
| Molecular Weight | 308.33100 |
| Exact Mass | 308.11600 |
| PSA | 67.08000 |
| LogP | 4.83510 |
| InChIKey | STXPUHITJKAFQG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCNc2ccccc2)c2ccccc12 |
|
~%
N-[2-(4-nitrona... CAS#:103769-08-0 |
| Literature: Mutai, Kiyoshi; Nakagaki, Ryoichi Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 12 p. 3663 - 3664 |
|
~58%
N-[2-(4-nitrona... CAS#:103769-08-0 |
| Literature: Mutai, Kiyoshi; Nakagaki, Ryoichi Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 12 p. 3663 - 3664 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |