Phenol,2-[3-ethyl-5-(4-methoxyphenyl)-1H-pyrazol-4-yl]- structure
|
Common Name | Phenol,2-[3-ethyl-5-(4-methoxyphenyl)-1H-pyrazol-4-yl]- | ||
|---|---|---|---|---|
| CAS Number | 1038-81-9 | Molecular Weight | 294.34800 | |
| Density | 1.192g/cm3 | Boiling Point | 474.7ºC at 760mmHg | |
| Molecular Formula | C18H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.9ºC | |
| Name | 2-[5-ethyl-3-(4-methoxyphenyl)-1H-pyrazol-4-yl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 474.7ºC at 760mmHg |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.34800 |
| Flash Point | 240.9ºC |
| Exact Mass | 294.13700 |
| PSA | 58.14000 |
| LogP | 4.02030 |
| Vapour Pressure | 1.24E-09mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | ODGRMKHYFIFZML-UHFFFAOYSA-N |
| SMILES | CCc1[nH]nc(-c2ccc(OC)cc2)c1-c1ccccc1O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(3-Ethyl-5-(4-methoxyphenyl)-1H-pyrazol-4-yl)phenol |