1-Cyclohexyl-5-methyl-3-phenylbarbituric acid structure
|
Common Name | 1-Cyclohexyl-5-methyl-3-phenylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 1038-85-3 | Molecular Weight | 300.35200 | |
| Density | 1.239g/cm3 | Boiling Point | 422.2ºC at 760mmHg | |
| Molecular Formula | C17H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.1ºC | |
| Name | 1-cyclohexyl-5-methyl-3-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 422.2ºC at 760mmHg |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.35200 |
| Flash Point | 178.1ºC |
| Exact Mass | 300.14700 |
| PSA | 57.69000 |
| LogP | 2.95350 |
| Vapour Pressure | 2.46E-07mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | IFXAQRYOAKJCMN-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(c2ccccc2)C(=O)N(C2CCCCC2)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| BARBITURIC ACID,1-CYCLOHEXYL-5-METHYL-3-PHENYL |
| 1-Phenyl-3-cyclohexyl-5-methylbarbitursaeure |
| 1-cyclohexyl-5-methyl-3-phenyl-pyrimidine-2,4,6-trione |
| 1-Cyclohexyl-5-methyl-3-phenylbarbituric acid |