5-bromo-8-methoxyquinoline-2-carboxylic acid structure
|
Common Name | 5-bromo-8-methoxyquinoline-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 103859-96-7 | Molecular Weight | 282.09000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-8-methoxyquinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8BrNO3 |
|---|---|
| Molecular Weight | 282.09000 |
| Exact Mass | 280.96900 |
| PSA | 59.42000 |
| LogP | 2.70410 |
| InChIKey | SKDJMNAJJIQPST-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)c2ccc(C(=O)O)nc12 |
|
~%
5-bromo-8-metho... CAS#:103859-96-7 |
| Literature: Irving; Pinnington Journal of the Chemical Society, 1957 , p. 290,293 |
|
~%
5-bromo-8-metho... CAS#:103859-96-7 |
| Literature: Irving; Pinnington Journal of the Chemical Society, 1957 , p. 290,293 |
|
~%
5-bromo-8-metho... CAS#:103859-96-7 |
| Literature: Irving; Pinnington Journal of the Chemical Society, 1957 , p. 290,293 |
| 5-bromo-8-methoxy-quinoline-2-carboxylic acid |
| 5-Brom-8-methoxy-chinolin-2-carbonsaeure |
| 2-Quinolinecarboxylic acid,5-bromo-8-methoxy |
| 8-methoxy-5-bromo-quinoline-2-carboxylic acid |