Propanedinitrile,2-(10-oxo-9(10H)-anthracenylidene)- structure
|
Common Name | Propanedinitrile,2-(10-oxo-9(10H)-anthracenylidene)- | ||
|---|---|---|---|---|
| CAS Number | 10395-02-5 | Molecular Weight | 256.25800 | |
| Density | 1.34g/cm3 | Boiling Point | 449.1ºC at 760mmHg | |
| Molecular Formula | C17H8N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4ºC | |
| Name | 2-(10-oxoanthracen-9-ylidene)propanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 449.1ºC at 760mmHg |
| Molecular Formula | C17H8N2O |
| Molecular Weight | 256.25800 |
| Flash Point | 225.4ºC |
| Exact Mass | 256.06400 |
| PSA | 64.65000 |
| LogP | 3.08006 |
| Vapour Pressure | 2.95E-08mmHg at 25°C |
| Index of Refraction | 1.674 |
| InChIKey | BZOPOLKEYVGAJI-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=C1c2ccccc2C(=O)c2ccccc21 |
|
~39%
Propanedinitril... CAS#:10395-02-5 |
| Literature: Loskutov Russian Journal of Organic Chemistry, 2000 , vol. 36, # 10 p. 1478 - 1481 |
|
~9%
Propanedinitril... CAS#:10395-02-5 |
| Literature: Bryce, Martin R.; Davies, Stephen R. Journal of the Chemical Society, Chemical Communications, 1989 , # 6 p. 328 - 329 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 11,11-dicyano-9,10-anthraquinone methide |
| propanedinitrile,(10-oxo-9(10h)-anthracenylidene) |
| 10-Dicyanmethylen-anthron |
| 10-dicyanomethylene-9-anthrone |
| 10-(dicyanomethylene)anthrone |
| 10-dicyanomethylene-9,10-dihydroanthracen-9-one |
| 10-Dicyanmethylen-9-anthron |