Benzeneacetamide,N-[2-(3,4-dimethoxyphenyl)ethyl]-4-nitro- structure
|
Common Name | Benzeneacetamide,N-[2-(3,4-dimethoxyphenyl)ethyl]-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 10403-40-4 | Molecular Weight | 344.36200 | |
| Density | 1.222g/cm3 | Boiling Point | 588.4ºC at 760mmHg | |
| Molecular Formula | C18H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.6ºC | |
| Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 588.4ºC at 760mmHg |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.36200 |
| Flash Point | 309.6ºC |
| Exact Mass | 344.13700 |
| PSA | 93.38000 |
| LogP | 3.42750 |
| Vapour Pressure | 8E-14mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | QGYYUOYOWZSANS-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)Cc2ccc([N+](=O)[O-])cc2)cc1OC |
| HS Code | 2924299090 |
|---|
|
~59%
Benzeneacetamid... CAS#:10403-40-4 |
| Literature: Feller, Dennis R.; Miller, Duane D. Patent: US2004/19079 A1, 2004 ; Location in patent: Page/Page column 17; 29 ; US 20040019079 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Nitro-phenylessigsaeure-<3,4-dimethoxy-phenaethylamid> |