|
N-(3-chloro-4-fluorophenyl)-3-{2-[(cyclohexylcarbamoyl)amino]-1,3-thiazol-4-yl}propanamide structure
|
Common Name | N-(3-chloro-4-fluorophenyl)-3-{2-[(cyclohexylcarbamoyl)amino]-1,3-thiazol-4-yl}propanamide | ||
|---|---|---|---|---|
| CAS Number | 1040670-03-8 | Molecular Weight | 424.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22ClFN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-chloro-4-fluorophenyl)-3-{2-[(cyclohexylcarbamoyl)amino]-1,3-thiazol-4-yl}propanamide |
|---|
| Molecular Formula | C19H22ClFN4O2S |
|---|---|
| Molecular Weight | 424.9 |