diethyl 1-phenylprop-1-enyl phosphate
Modify Date: 2025-09-13 11:21:49
diethyl 1-phenylprop-1-enyl phosphate structure
|
Common Name | diethyl 1-phenylprop-1-enyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 10409-51-5 | Molecular Weight | 270.26100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H19O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 1-phenylprop-1-enyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H19O4P |
|---|---|
| Molecular Weight | 270.26100 |
| Exact Mass | 270.10200 |
| PSA | 54.57000 |
| LogP | 4.24510 |
| InChIKey | WUWZIIZECKVKEL-UHFFFAOYSA-N |
| SMILES | CC=C(OP(=O)(OCC)OCC)c1ccccc1 |
|
~7%
diethyl 1-pheny... CAS#:10409-51-5
Detail
|
| Literature: Takai; Sato; Oshima; Nozaki Bulletin of the Chemical Society of Japan, 1984 , vol. 57, # 1 p. 108 - 115 |
|
~%
diethyl 1-pheny... CAS#:10409-51-5 |
| Literature: Takai, Kazuhiko; Oshima, Koichiro; Nozaki, Hitosi Tetrahedron Letters, 1980 , vol. 21, p. 2531 - 2534 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Z-Diaethyl-1-phenyl-1-propenyl-phosphat |
| phosphoric acid diethyl ester 1-phenyl-propenyl ester |
| phosphoric acid diethyl 1-phenylpropenyl ester |