1-Propanone,3-(1-piperidinyl)-1-(3,4,5-trimethoxyphenyl)-, hydrochloride (1:1) structure
|
Common Name | 1-Propanone,3-(1-piperidinyl)-1-(3,4,5-trimethoxyphenyl)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1041-10-7 | Molecular Weight | 343.84600 | |
| Density | 1.086g/cm3 | Boiling Point | 440.4ºC at 760mmHg | |
| Molecular Formula | C17H26ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.1ºC | |
| Name | 3-piperidin-1-yl-1-(3,4,5-trimethoxyphenyl)propan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.086g/cm3 |
|---|---|
| Boiling Point | 440.4ºC at 760mmHg |
| Molecular Formula | C17H26ClNO4 |
| Molecular Weight | 343.84600 |
| Flash Point | 220.1ºC |
| Exact Mass | 343.15500 |
| PSA | 48.00000 |
| LogP | 3.51100 |
| Vapour Pressure | 5.92E-08mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | IHPCDKQYNLLUAY-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)CCN2CCCCC2)cc(OC)c1OC.Cl |
|
~%
1-Propanone,3-(... CAS#:1041-10-7 |
| Literature: Magdziarz, Tomasz; Lozowicka, Bozena; Gieleciak, Rafal; Bak, Andrzej; Polanski, Jaroslaw; Chilmonczyk, Zdzislaw Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 5 p. 1630 - 1643 |
|
~%
1-Propanone,3-(... CAS#:1041-10-7 |
| Literature: Haggett; Archer Journal of the American Chemical Society, 1949 , vol. 71, p. 2255 |
| 3-Piperidino-1-(3,4,5-trimethoxy-phenyl)-propan-1-on,Hydrochlorid |
| 3-(piperidin-1-yl)-1-(3,4,5-trimethoxyphenyl)propan-1-one hydrochloride |
| 3-piperidino-1-(3,4,5-trimethoxy-phenyl)-propan-1-one,hydrochloride |