2-(2-Hydroxy-3-oxobutan-2-yl)-2,5-dimethylfuran-3(2H)-one structure
|
Common Name | 2-(2-Hydroxy-3-oxobutan-2-yl)-2,5-dimethylfuran-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 10410-20-5 | Molecular Weight | 198.216 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 320.7±30.0 °C at 760 mmHg | |
| Molecular Formula | C10H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.8±18.1 °C | |
| Name | 2-(2-hydroxy-3-oxobutan-2-yl)-2,5-dimethylfuran-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.7±30.0 °C at 760 mmHg |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.216 |
| Flash Point | 123.8±18.1 °C |
| Exact Mass | 198.089203 |
| PSA | 63.60000 |
| LogP | 0.69 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | CAIJWAJUXIPUNS-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)(O)C1(C)OC(C)=CC1=O |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-C-Acetyl-1,4-anhydro-2,6-dideoxy-1,4-dimethylhex-1-en-3-ulose |
| 2-(2-hydroxy-3-oxobutan-2-yl)-2,5-dimethylfuran-3(2H)-one |
| 3(2H)-Furanone, 2-(1-hydroxy-1-methyl-2-oxopropyl)-2,5-dimethyl- |
| Hex-1-en-3-ulose, 5-C-acetyl-1,4-anhydro-2,6-dideoxy-1,4-di-C-methyl- |
| EINECS 233-880-1 |