Benzoic acid,4-methoxy-, carboxymethyl ester structure
|
Common Name | Benzoic acid,4-methoxy-, carboxymethyl ester | ||
|---|---|---|---|---|
| CAS Number | 10414-68-3 | Molecular Weight | 210.18300 | |
| Density | 1.293g/cm3 | Boiling Point | 410.3ºC at 760mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.8ºC | |
| Name | 2-(4-methoxybenzoyl)oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 410.3ºC at 760mmHg |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18300 |
| Flash Point | 165.8ºC |
| Exact Mass | 210.05300 |
| PSA | 72.83000 |
| LogP | 0.93660 |
| Vapour Pressure | 1.82E-07mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | MZSAEUPZUUESSL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OCC(=O)O)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
Benzoic acid,4-... CAS#:10414-68-3 |
| Literature: Ringshaw,D.J.; Smith,H.J. Journal of the Chemical Society, 1964 , p. 1559 - 1562 |
|
~%
Benzoic acid,4-... CAS#:10414-68-3 |
| Literature: Ringshaw,D.J.; Smith,H.J. Journal of the Chemical Society, 1964 , p. 1559 - 1562 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Methoxy-benzoyloxy)-essigsaeure |
| 4-Mboaa |
| Anisoyloxyessigsaeure |
| O-(4-Methoxy-benzoyl)-glykolsaeure |
| Anisoylglykolsaeure |
| (4-methoxy-benzoyloxy)-acetic acid |