4-[(4-aminophenyl)methyl]-2-chloroaniline structure
|
Common Name | 4-[(4-aminophenyl)methyl]-2-chloroaniline | ||
|---|---|---|---|---|
| CAS Number | 10414-75-2 | Molecular Weight | 232.70900 | |
| Density | 1.255g/cm3 | Boiling Point | 400.7ºC at 760mmHg | |
| Molecular Formula | C13H13ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.1ºC | |
| Name | 4-[(4-aminophenyl)methyl]-2-chloroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 400.7ºC at 760mmHg |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.70900 |
| Flash Point | 196.1ºC |
| Exact Mass | 232.07700 |
| PSA | 52.04000 |
| LogP | 4.25760 |
| Vapour Pressure | 1.25E-06mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | FABSKOVJDIDCHX-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cc2ccc(N)c(Cl)c2)cc1 |
| HS Code | 2921590090 |
|---|
|
~71%
4-[(4-aminophen... CAS#:10414-75-2 |
| Literature: Katritzky, Alan R.; Lan, Xiangfu; Lam, Jamshed N. Synthesis, 1990 , p. 341 - 346 |
|
~%
4-[(4-aminophen... CAS#:10414-75-2 |
| Literature: Katritzky, Alan R.; Lan, Xiangfu; Lam, Jamshed N. Synthesis, 1990 , p. 341 - 346 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 233-885-9 |