2'-Amino-2'-deoxyadenosine structure
|
Common Name | 2'-Amino-2'-deoxyadenosine | ||
|---|---|---|---|---|
| CAS Number | 10414-81-0 | Molecular Weight | 266.25700 | |
| Density | 2.08 g/cm3 | Boiling Point | 657.6ºC | |
| Molecular Formula | C10H14N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 351.5ºC | |
| Name | 2'-Amino-2'-deoxyadenosine |
|---|---|
| Synonym | More Synonyms |
| Density | 2.08 g/cm3 |
|---|---|
| Boiling Point | 657.6ºC |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.25700 |
| Flash Point | 351.5ºC |
| Exact Mass | 266.11300 |
| PSA | 145.33000 |
| Appearance of Characters | Powder | White to Off-white |
| Index of Refraction | 1.935 |
| InChIKey | CQKMBZHLOYVGHW-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C(O)C1N |
| Storage condition | 2~8°C |
| Water Solubility | Soluble in DMSO. |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2'-NH2-dA |
| 2'-AMINO-D-ADENOSINE |
| Adenosine,2'-amino,-2'-deoxy |
| 2'-amino-2'-deoxy-adenosine |
| 2'-Aminoadenosine |
| 2'-Amino-2'-deoxy-D-adenosine |