10,11-methylenedioxy-20-camptothecin
Modify Date: 2025-09-18 18:24:43
10,11-methylenedioxy-20-camptothecin structure
|
Common Name | 10,11-methylenedioxy-20-camptothecin | ||
|---|---|---|---|---|
| CAS Number | 104155-89-7 | Molecular Weight | 392.36200 | |
| Density | 1.64g/cm3 | Boiling Point | 812.1ºC at 760mmHg | |
| Molecular Formula | C21H16N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 445ºC | |
| Name | Mdo-cpt |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 812.1ºC at 760mmHg |
| Molecular Formula | C21H16N2O6 |
| Molecular Weight | 392.36200 |
| Flash Point | 445ºC |
| Exact Mass | 392.10100 |
| PSA | 99.88000 |
| LogP | 1.80830 |
| Vapour Pressure | 7.11E-28mmHg at 25°C |
| Index of Refraction | 1.773 |
| InChIKey | RPFYDENHBPRCTN-NRFANRHFSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3cc4c(cc3nc2-1)OCO4 |
|
~46%
10,11-methylene... CAS#:104155-89-7 |
| Literature: Wani; Nicholas; Wall Journal of Medicinal Chemistry, 1986 , vol. 29, # 11 p. 2358 - 2363 |
![(±)- 1H-Pyrano[3,4-f]indolizine-3,6,10(4H)-trione, 4-ethyl-7,8-dihydro-4-hydroxy structure](https://image.chemsrc.com/caspic/342/102978-40-5.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 10,11-CH2O2-Camptothecin |
| 10,11-Methylenedioxy-20S-camptothecin |
| 10,11-Methylenedioxycamptothecin |
| 10,11-METHYLENEDIOXY-20-CAMPTOTHECIN |
| 10,11-MD-CPT |